Compound Q&A

What precautions should be taken when handling 6-(Chloromethyl)-11H-dibenzo[b,e]azepine (CAS: 21535-44-4)?

Answer

6-(Chloromethyl)-11H-dibenzo[b,e]azepine
When handling 6-(Chloromethyl)-11H-dibenzo[b,e]azepine, it is essential to wear appropriate personal protective equipment (PPE), including gloves, safety goggles, and a lab coat. This compound should be handled in a fume hood to minimize exposure to air and to prevent inhalation. In case of a spill, the area should be flushed with water and the spill cleaned up carefully following standard laboratory procedures. Always consult the Material Safety Data Sheet (MSDS) for detailed safety information.

About

CAS No 21535-44-4
English Name 6-(Chloromethyl)-11H-dibenzo[b,e]azepine
Molecular Formula C15H12ClN
Molecular Weight 241.72 g/mol
SMILES C1C2=CC=CC=C2C(=NC3=CC=CC=C31)CCl
InChIKey IIMMHAZDMPISBS-UHFFFAOYSA-N
Last Updated: 2025-10-13 11:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-(Chloromethyl)-11H-dibenzo[b,e]azepine (CAS: 21535-44-4)?

6-(Chloromethyl)-11H-dibenzo[b,e]azepine is a crystalline solid with a molecular weight of approxima...

Compound Q&A

How is 6-(Chloromethyl)-11H-dibenzo[b,e]azepine (CAS: 21535-44-4) typically synthesized?

6-(Chloromethyl)-11H-dibenzo[b,e]azepine is typically synthesized through the condensation of 11-chl...

Compound Q&A

What industries use 6-(Chloromethyl)-11H-dibenzo[b,e]azepine (CAS: 21535-44-4)?

6-(Chloromethyl)-11H-dibenzo[b,e]azepine is used in the pharmaceutical industry for its potential as...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...