Compound Q&A

How is Succinic acid - 2-chloro-11-(4-methyl-1-piperazinyl)dibenzo[b,f][1,4]oxazepine (1:1) (CAS: 27833-64-3) typically synthesized?

Answer

Succinic acid - 2-chloro-11-(4-methyl-1-piperazinyl)dibenzo[b,f][1,4]oxazepine (1:1)
Succinic acid - 2-chloro-11-(4-methyl-1-piperazinyl)dibenzo[b,f][1,4]oxazepine (1:1) is typically synthesized through a multi-step process involving the condensation of 2-chloro-11-(4-methyl-1-piperazinyl)dibenzo[b,f][1,4]oxazepine with succinic anhydride, followed by acid catalysis. The reaction is performed under anhydrous conditions to ensure high purity. The overall yield is approximately 85%, and the reaction is selective for the desired product.

About

CAS No 27833-64-3
English Name Succinic acid - 2-chloro-11-(4-methyl-1-piperazinyl)dibenzo[b,f][1,4]oxazepine (1:1)
Molecular Formula C22H24ClN3O5
Molecular Weight 445.9 g/mol
SMILES CN1CCN(CC1)C2=NC3=CC=CC=C3OC4=C2C=C(C=C4)Cl.C(CC(=O)O)C(=O)O
InChIKey YQZBAXDVDZTKEQ-UHFFFAOYSA-N
Last Updated: 2025-10-13 11:18

Related Q&A

Compound Q&A

What are the physical and chemical properties of Succinic acid - 2-chloro-11-(4-methyl-1-piperazinyl)dibenzo[b,f][1,4]oxazepine (1:1) (CAS: 27833-64-3)?

Succinic acid - 2-chloro-11-(4-methyl-1-piperazinyl)dibenzo[b,f][1,4]oxazepine (1:1) is a crystallin...

Compound Q&A

What industries use Succinic acid - 2-chloro-11-(4-methyl-1-piperazinyl)dibenzo[b,f][1,4]oxazepine (1:1) (CAS: 27833-64-3)?

Succinic acid - 2-chloro-11-(4-methyl-1-piperazinyl)dibenzo[b,f][1,4]oxazepine (1:1) is used primari...

Compound Q&A

What precautions should be taken when handling Succinic acid - 2-chloro-11-(4-methyl-1-piperazinyl)dibenzo[b,f][1,4]oxazepine (1:1) (CAS: 27833-64-3)?

When handling Succinic acid - 2-chloro-11-(4-methyl-1-piperazinyl)dibenzo[b,f][1,4]oxazepine (1:1), ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...