Compound Q&A

What are the physical and chemical properties of Ophiopogonin D' (CAS: 65604-80-0)?

Answer

Ophiopogonin D'
Ophiopogonin D' is a white crystalline compound with a molecular weight of approximately 472.4 g/mol. It is slightly soluble in water and ethanol but more soluble in organic solvents. Ophiopogonin D' exhibits moderate reactivity, particularly with nucleophiles, and is stable under neutral and slightly acidic conditions.

About

CAS No 65604-80-0
English Name Ophiopogonin D'
Molecular Formula C44H70O16
Molecular Weight 855.03 g/mol
SMILES O1[C@@H]4[C@H]([C@@H]([C@]12OC[C@@H](CC2)C)C)[C@@]5(C)CC[C@@H]3[C@@]9(C(=C/C[C@H]3[C@@H]5C4)\C[C@@H](O[C@@H]8O[C@H](CO)[C@@H](O)[C@H](O[C@@H]6OC[C@@H](O)[C@H](O)[C@H]6O)[C@H]8O[C@@H]7O[C@@H](C)[C@H](O)[C@@H](O)[C@H]7O)CC9)C
InChIKey DQYACEDUQHWXQZ-QOYNBSPSSA-N
Last Updated: 2025-10-13 11:18

Related Q&A

Compound Q&A

How is Ophiopogonin D' (CAS: 65604-80-0) typically synthesized?

Ophiopogonin D' is synthesized via a complex multistep process involving protection of the sugar moi...

Compound Q&A

What industries use Ophiopogonin D' (CAS: 65604-80-0)?

Ophiopogonin D' is primarily used in the pharmaceutical industry due to its potential as a natural p...

Compound Q&A

What precautions should be taken when handling Ophiopogonin D' (CAS: 65604-80-0)?

When handling Ophiopogonin D', use appropriate PPE such as gloves, goggles, and a lab coat. Work in ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...