Compound Q&A

What is 2-(4-Bromophenyl)-2-methylpropanoic acid (CAS: 32454-35-6)?

Answer

2-(4-Bromophenyl)-2-methylpropanoic acid
2-(4-Bromophenyl)-2-methylpropanoic acid (CAS: 32454-35-6) is an organic compound with the molecular formula C9H9BrO2. It is a colorless solid with a melting point of 58-60°C and a pKa of approximately 4.5. This compound is used in various industries including pharmaceuticals and research for its specific functional groups.

About

CAS No 32454-35-6
English Name 2-(4-Bromophenyl)-2-methylpropanoic acid
Molecular Formula C10H11BrO2
Molecular Weight 243.1 g/mol
SMILES CC(C)(C1=CC=C(C=C1)Br)C(=O)O
InChIKey AKVOQXBQLXOEEF-UHFFFAOYSA-N
Last Updated: 2025-10-13 00:22

Related Q&A

Compound Q&A

What are the main uses of 2-(4-Bromophenyl)-2-methylpropanoic acid (CAS: 32454-35-6)?

2-(4-Bromophenyl)-2-methylpropanoic acid (CAS: 32454-35-6) is primarily used in pharmaceutical resea...

Compound Q&A

Is 2-(4-Bromophenyl)-2-methylpropanoic acid (CAS: 32454-35-6) safe?

2-(4-Bromophenyl)-2-methylpropanoic acid (CAS: 32454-35-6) is generally safe when handled under prop...

Compound Q&A

How should 2-(4-Bromophenyl)-2-methylpropanoic acid (CAS: 32454-35-6) be stored?

2-(4-Bromophenyl)-2-methylpropanoic acid (CAS: 32454-35-6) should be stored in a cool, dry place awa...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...