Compound Q&A

What are the main uses of 1-Butyl-3-methyl-1H-imidazol-3-ium nitrate (CAS: 179075-88-8)?

Answer

1-Butyl-3-methyl-1H-imidazol-3-ium nitrate
1-Butyl-3-methyl-1H-imidazol-3-ium nitrate (CAS: 179075-88-8) is primarily used in the pharmaceutical industry as a precursor for the synthesis of other compounds. It is also used in the development of organic synthesis reagents and as a component in certain chemical reactions.

About

English Name 1-Butyl-3-methyl-1H-imidazol-3-ium nitrate
Molecular Formula C8H15N3O3
Molecular Weight 203.24 g/mol
SMILES [O-][N+](=O)[O-].CCCCN1C=C[NH+](C1)C
InChIKey WPHIMOZSRUCGGU-UHFFFAOYSA-N
Last Updated: 2025-10-12 23:04

Related Q&A

Compound Q&A

What is 1-Butyl-3-methyl-1H-imidazol-3-ium nitrate (CAS: 179075-88-8)?

1-Butyl-3-methyl-1H-imidazol-3-ium nitrate (CAS: 179075-88-8) is an imidazole derivative used in var...

Compound Q&A

Is 1-Butyl-3-methyl-1H-imidazol-3-ium nitrate (CAS: 179075-88-8) safe?

1-Butyl-3-methyl-1H-imidazol-3-ium nitrate (CAS: 179075-88-8) is generally considered safe when hand...

Compound Q&A

How should 1-Butyl-3-methyl-1H-imidazol-3-ium nitrate (CAS: 179075-88-8) be stored?

1-Butyl-3-methyl-1H-imidazol-3-ium nitrate (CAS: 179075-88-8) should be stored in a cool, dry place ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...