Compound Q&A

How should (R)-4-Nitrobenzyl 2-diazo-4-((2R,3S)-3-((R)-1-hydroxy-ethyl)-4-oxoazetidin-2-yl)-3-oxopentanoate (CAS: 90822-24-5) be stored?

Answer

(R)-4-Nitrobenzyl 2-diazo-4-((2R,3S)-3-((R)-1-hydroxy-ethyl)-4-oxoazetidin-2-yl)-3-oxopentanoate
This compound should be stored in a cool, dry, and well-ventilated area away from direct sunlight and heat sources. It should be kept in a tightly sealed container to prevent moisture and light exposure. Refrigeration is not typically required but can be considered for prolonged storage to maintain stability.

About

CAS No 90822-24-5
English Name (R)-4-Nitrobenzyl 2-diazo-4-((2R,3S)-3-((R)-1-hydroxy-ethyl)-4-oxoazetidin-2-yl)-3-oxopentanoate
Molecular Formula C17H18N4O7
Molecular Weight 390.35 g/mol
SMILES CC(C1C(NC1=O)C(C)C(=O)C(=[N+]=[N-])C(=O)OCC2=CC=C(C=C2)[N+](=O)[O-])O
InChIKey FDXUXRZSNNSUGD-NRMKKVEVSA-N
Last Updated: 2025-10-12 21:45

Related Q&A

Compound Q&A

What is (R)-4-Nitrobenzyl 2-diazo-4-((2R,3S)-3-((R)-1-hydroxy-ethyl)-4-oxoazetidin-2-yl)-3-oxopentanoate (CAS: 90822-24-5)?

This compound is a nitrogen mustard derivative with a complex molecular structure. It is characteriz...

Compound Q&A

What are the main uses of (R)-4-Nitrobenzyl 2-diazo-4-((2R,3S)-3-((R)-1-hydroxy-ethyl)-4-oxoazetidin-2-yl)-3-oxopentanoate (CAS: 90822-24-5)?

This compound is primarily used as an intermediate in the synthesis of pharmaceuticals, particularly...

Compound Q&A

Is (R)-4-Nitrobenzyl 2-diazo-4-((2R,3S)-3-((R)-1-hydroxy-ethyl)-4-oxoazetidin-2-yl)-3-oxopentanoate (CAS: 90822-24-5) safe?

While this compound is not inherently dangerous, it requires strict handling due to its reactivity a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...