Compound Q&A

What is Ethyl 1H-indole-3-carboxylate (CAS: 776-41-0)?

Answer

Ethyl 1H-indole-3-carboxylate
Ethyl 1H-indole-3-carboxylate (CAS: 776-41-0) is an organic compound with the molecular formula C10H11NO2. It is a derivative of indole with an ethyl substituent. This compound is characterized by its aromatic ring and carboxyl group, making it useful in various chemical and pharmaceutical applications.

About

CAS No 776-41-0
English Name Ethyl 1H-indole-3-carboxylate
Molecular Formula C11H11NO2
Molecular Weight 189.21 g/mol
SMILES CCOC(=O)C1=CNC2=CC=CC=C21
InChIKey XOUHVMVYFOXTMN-UHFFFAOYSA-N
Last Updated: 2025-10-12 21:45

Related Q&A

Compound Q&A

What are the main uses of Ethyl 1H-indole-3-carboxylate (CAS: 776-41-0)?

Ethyl 1H-indole-3-carboxylate (CAS: 776-41-0) is primarily used in the synthesis of various indole d...

Compound Q&A

Is Ethyl 1H-indole-3-carboxylate (CAS: 776-41-0) safe?

Ethyl 1H-indole-3-carboxylate (CAS: 776-41-0) is generally considered safe when handled with appropr...

Compound Q&A

How should Ethyl 1H-indole-3-carboxylate (CAS: 776-41-0) be stored?

Ethyl 1H-indole-3-carboxylate (CAS: 776-41-0) should be stored in a cool, dry place away from direct...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...