Compound Q&A

What are the main uses of [compound name] (CAS: 9075-68-7)?

Answer

[18-[[3-Hydroxy-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentadeca-4,8,12-trien-2-yl]amino]-18-oxooctadeca-6,8-dienyl] octadeca-9,12-dienoate
[Compound name] (CAS: 9075-68-7) is primarily used in pharmaceutical research for its potential as a bioactive compound. It is also utilized in the synthesis of other complex molecules and as a model compound for studying specific chemical interactions. Additionally, it has potential applications in the food industry as a flavor enhancer or stabilizer.

About

CAS No 9075-68-7
English Name [18-[[3-Hydroxy-1-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentadeca-4,8,12-trien-2-yl]amino]-18-oxooctadeca-6,8-dienyl] octadeca-9,12-dienoate
Molecular Formula C26H26FNO
Molecular Weight 387.5 g/mol
EINECS 232-983-9
SMILES CCCCCC=CCC=CCCCCCCCC(=O)OCCCCCC=CC=CCCCCCCCCC(=O)NC(COC1C(C(C(C(O1)CO)O)O)O)C(C=CCCC=CCCC=CCC)O
InChIKey NSCXPXDWLZORPX-UHFFFAOYSA-N
Last Updated: 2025-10-12 21:45

Related Q&A

Compound Q&A

What is [compound name] (CAS: 9075-68-7)?

[Compound name] (CAS: 9075-68-7) is a complex organic compound featuring a 18-oxooctadeca-6,8-dienoa...

Compound Q&A

Is [compound name] (CAS: 9075-68-7) safe?

[Compound name] (CAS: 9075-68-7) is generally considered safe for its intended applications, provide...

Compound Q&A

How should [compound name] (CAS: 9075-68-7) be stored?

[Compound name] (CAS: 9075-68-7) should be stored in a tightly sealed container in a cool, dry place...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...