Compound Q&A

What are the main uses of Ethyl 4,6-dichloro-3-pyridazinecarboxylate (CAS: 679406-03-2)?

Answer

Ethyl 4,6-dichloro-3-pyridazinecarboxylate
Ethyl 4,6-dichloro-3-pyridazinecarboxylate (CAS: 679406-03-2) is primarily used in pharmaceutical research for the synthesis of drug intermediates. It is also utilized in the development of agrochemicals and for the production of certain dyes. Due to its specific chemical properties, it finds applications in various industries requiring precise chemical transformations.

About

English Name Ethyl 4,6-dichloro-3-pyridazinecarboxylate
Molecular Formula C7H6Cl2N2O2
Molecular Weight 221.04 g/mol
SMILES CCOC(=O)C1=NN=C(C=C1Cl)Cl
InChIKey MOWPWJUYSRHMHS-UHFFFAOYSA-N
Last Updated: 2025-10-12 21:45

Related Q&A

Compound Q&A

What is Ethyl 4,6-dichloro-3-pyridazinecarboxylate (CAS: 679406-03-2)?

Ethyl 4,6-dichloro-3-pyridazinecarboxylate (CAS: 679406-03-2) is a chemical compound with the molecu...

Compound Q&A

Is Ethyl 4,6-dichloro-3-pyridazinecarboxylate (CAS: 679406-03-2) safe?

Ethyl 4,6-dichloro-3-pyridazinecarboxylate (CAS: 679406-03-2) is generally considered safe under con...

Compound Q&A

How should Ethyl 4,6-dichloro-3-pyridazinecarboxylate (CAS: 679406-03-2) be stored?

Ethyl 4,6-dichloro-3-pyridazinecarboxylate (CAS: 679406-03-2) should be stored in a cool, dark, and ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...