Compound Q&A

What are the main uses of 3-Nitro-5-(trifluoromethyl)benzoic acid (CAS: 328-80-3)?

Answer

3-Nitro-5-(trifluoromethyl)benzoic acid
3-Nitro-5-(trifluoromethyl)benzoic acid is primarily used as an intermediate in the synthesis of pharmaceuticals and agrochemicals. It also finds applications in research and development, particularly in organic synthesis and materials science.

About

CAS No 328-80-3
English Name 3-Nitro-5-(trifluoromethyl)benzoic acid
Molecular Formula C8H4F3NO4
Molecular Weight 235.12 g/mol
SMILES C1=C(C=C(C=C1C(F)(F)F)[N+](=O)[O-])C(=O)O
InChIKey ODCLHXGXGFBBTA-UHFFFAOYSA-N
Last Updated: 2025-10-12 15:22

Related Q&A

Compound Q&A

What is 3-Nitro-5-(trifluoromethyl)benzoic acid (CAS: 328-80-3)?

3-Nitro-5-(trifluoromethyl)benzoic acid (CAS: 328-80-3) is an organic compound with the molecular fo...

Compound Q&A

Is 3-Nitro-5-(trifluoromethyl)benzoic acid (CAS: 328-80-3) safe?

3-Nitro-5-(trifluoromethyl)benzoic acid (CAS: 328-80-3) is generally safe when handled with appropri...

Compound Q&A

How should 3-Nitro-5-(trifluoromethyl)benzoic acid (CAS: 328-80-3) be stored?

3-Nitro-5-(trifluoromethyl)benzoic acid (CAS: 328-80-3) should be stored in a tightly sealed contain...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...