Compound Q&A

What are the main uses of Sodium [(4-aminophenyl)sulfonyl](5-methyl-1,2-oxazol-3-yl)azanide (CAS: 4563-84-2)?

Answer

Sodium [(4-aminophenyl)sulfonyl](5-methyl-1,2-oxazol-3-yl)azanide
Sodium [(4-aminophenyl)sulfonyl](5-methyl-1,2-oxazol-3-yl)azanide is primarily used in pharmaceutical research and development. It serves as a key intermediate in the synthesis of various drug compounds, particularly those targeting specific biological pathways. Additionally, it finds applications in the synthesis of other complex organic molecules and in academic research for understanding chemical reactivity.

About

CAS No 4563-84-2
English Name Sodium [(4-aminophenyl)sulfonyl](5-methyl-1,2-oxazol-3-yl)azanide
Molecular Formula C10H10N3NaO3S
Molecular Weight 275.26 g/mol
SMILES CC1=CC(=NO1)[N-]S(=O)(=O)C2=CC=C(C=C2)N.[Na+]
InChIKey LARLNXOUTTUXPN-UHFFFAOYSA-N
Last Updated: 2025-10-12 15:22

Related Q&A

Compound Q&A

What is Sodium [(4-aminophenyl)sulfonyl](5-methyl-1,2-oxazol-3-yl)azanide (CAS: 4563-84-2)?

Sodium [(4-aminophenyl)sulfonyl](5-methyl-1,2-oxazol-3-yl)azanide is a complex organic compound with...

Compound Q&A

Is Sodium [(4-aminophenyl)sulfonyl](5-methyl-1,2-oxazol-3-yl)azanide (CAS: 4563-84-2) safe?

Sodium [(4-aminophenyl)sulfonyl](5-methyl-1,2-oxazol-3-yl)azanide is generally considered safe when ...

Compound Q&A

How should Sodium [(4-aminophenyl)sulfonyl](5-methyl-1,2-oxazol-3-yl)azanide (CAS: 4563-84-2) be stored?

Sodium [(4-aminophenyl)sulfonyl](5-methyl-1,2-oxazol-3-yl)azanide should be stored in a cool, dry pl...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...