Compound Q&A

How should BETA-GLUCAN (CAS: 160872-27-5) be stored?

Answer

BETA-GLUCAN
To maintain the effectiveness and safety of beta-glucan, store it in a cool, dry place away from direct sunlight and moisture. Keep the container tightly sealed and avoid exposure to high temperatures. Proper storage conditions are crucial to prevent degradation and ensure the product remains stable and effective over time.

About

English Name BETA-GLUCAN
Molecular Formula C18H32O16
Molecular Weight 504.44 g/mol
EINECS 000-000-0
SMILES OC[C@H]1O[C@@H](OC2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O
InChIKey FYGDTMLNYKFZSV-WFYNLLPOSA-N
Last Updated: 2025-10-12 15:22

Related Q&A

Compound Q&A

What is BETA-GLUCAN (CAS: 160872-27-5)?

Beta-glucan is a type of soluble dietary fiber found in the cell walls of grains, yeasts, and fungi....

Compound Q&A

What are the main uses of BETA-GLUCAN (CAS: 160872-27-5)?

Beta-glucan is widely used in the pharmaceutical industry for immunomodulatory and blood sugar-regul...

Compound Q&A

Is BETA-GLUCAN (CAS: 160872-27-5) safe?

Beta-glucan is generally considered safe for consumption. However, individuals with specific medical...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...