Compound Q&A

What is O,O-Bis(2-methyl-2-propanyl) diimidothiotricarbonate (CAS: 145013-05-4)?

Answer

O,O-Bis(2-methyl-2-propanyl) diimidothiotricarbonate
O,O-Bis(2-methyl-2-propanyl) diimidothiotricarbonate is a complex chemical compound with a unique structure combining sulfur, carbon, and oxygen atoms. It is characterized by its ability to form stable thioether bonds and has a distinct chemical formula and molecular weight. This compound is typically prepared through specific synthetic methods and is known for its reactivity in organic synthesis.

About

English Name O,O-Bis(2-methyl-2-propanyl) diimidothiotricarbonate
Molecular Formula C11H20N2O4S
Molecular Weight 276.36 g/mol
SMILES CC(C)(C)OC(=O)NC(=S)NC(=O)OC(C)(C)C
InChIKey CSOJECDGWHHWRS-UHFFFAOYSA-N
Last Updated: 2025-10-12 15:22

Related Q&A

Compound Q&A

What are the main uses of O,O-Bis(2-methyl-2-propanyl) diimidothiotricarbonate (CAS: 145013-05-4)?

O,O-Bis(2-methyl-2-propanyl) diimidothiotricarbonate is primarily used in the synthesis of various o...

Compound Q&A

Is O,O-Bis(2-methyl-2-propanyl) diimidothiotricarbonate (CAS: 145013-05-4) safe?

O,O-Bis(2-methyl-2-propanyl) diimidothiotricarbonate is generally safe when handled with appropriate...

Compound Q&A

How should O,O-Bis(2-methyl-2-propanyl) diimidothiotricarbonate (CAS: 145013-05-4) be stored?

O,O-Bis(2-methyl-2-propanyl) diimidothiotricarbonate should be stored in a cool, dry place, away fro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...