Compound Q&A

What is 2-{[Bis(4-fluorophenyl)methyl]sulfinyl}-N-hydroxyacetamide (CAS: 90212-80-9)?

Answer

2-{[Bis(4-fluorophenyl)methyl]sulfinyl}-N-hydroxyacetamide
2-{[Bis(4-fluorophenyl)methyl]sulfinyl}-N-hydroxyacetamide, also known as PF-04147817 (CAS: 90212-80-9), is a chemical compound with a unique structure that includes sulfinyl and hydroxyacetamide functional groups. It is used primarily in medicinal chemistry and drug development for its potential in treating various diseases.

About

CAS No 90212-80-9
English Name 2-{[Bis(4-fluorophenyl)methyl]sulfinyl}-N-hydroxyacetamide
Molecular Formula C15H13F2NO3S
Molecular Weight 325.34 g/mol
SMILES ONC(=O)CS(=O)C(c1ccc(cc1)F)c1ccc(cc1)F
InChIKey VKGUUSVYPXTWMA-UHFFFAOYSA-N
Last Updated: 2025-10-12 11:11

Related Q&A

Compound Q&A

What are the main uses of 2-{[Bis(4-fluorophenyl)methyl]sulfinyl}-N-hydroxyacetamide (CAS: 90212-80-9)?

2-{[Bis(4-fluorophenyl)methyl]sulfinyl}-N-hydroxyacetamide (CAS: 90212-80-9) is primarily used in ph...

Compound Q&A

Is 2-{[Bis(4-fluorophenyl)methyl]sulfinyl}-N-hydroxyacetamide (CAS: 90212-80-9) safe?

2-{[Bis(4-fluorophenyl)methyl]sulfinyl}-N-hydroxyacetamide (CAS: 90212-80-9) is safe when handled wi...

Compound Q&A

How should 2-{[Bis(4-fluorophenyl)methyl]sulfinyl}-N-hydroxyacetamide (CAS: 90212-80-9) be stored?

2-{[Bis(4-fluorophenyl)methyl]sulfinyl}-N-hydroxyacetamide (CAS: 90212-80-9) should be stored in a c...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...