Compound Q&A

What is N-Carbobenzoxy-dl-leucine (CAS: 3588-60-1)?

Answer

N-Carbobenzoxy-dl-leucine
N-Carbobenzoxy-dl-leucine is a protected amino acid derivative used in chemical synthesis. It has the molecular formula C15H14NO3. This compound is characterized by its capability to serve as a protecting group for the carboxyl group of amino acids during chemical reactions.

About

CAS No 3588-60-1
English Name N-Carbobenzoxy-dl-leucine
Molecular Formula C14H19NO4
Molecular Weight 265.31 g/mol
SMILES CC(C)CC(NC(=O)OCc1ccccc1)C(=O)O
InChIKey USPFMEKVPDBMCG-UHFFFAOYSA-N
Last Updated: 2025-10-12 11:11

Related Q&A

Compound Q&A

What are the main uses of N-Carbobenzoxy-dl-leucine (CAS: 3588-60-1)?

N-Carbobenzoxy-dl-leucine is primarily used in the pharmaceutical and chemical industry for the synt...

Compound Q&A

Is N-Carbobenzoxy-dl-leucine (CAS: 3588-60-1) safe?

N-Carbobenzoxy-dl-leucine is generally considered safe for laboratory use when handled with appropri...

Compound Q&A

How should N-Carbobenzoxy-dl-leucine (CAS: 3588-60-1) be stored?

N-Carbobenzoxy-dl-leucine should be stored in a cool, dry environment, protected from moisture and l...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...