Compound Q&A

What is N~2~-Acetyl-L-glutaminyl-L-alpha-aspartyl-L-valyl-L-histidine (CAS: 928006-50-2)?

Answer

N~2~-Acetyl-L-glutaminyl-L-alpha-aspartyl-L-valyl-L-histidine
N~2~-Acetyl-L-glutaminyl-L-alpha-aspartyl-L-valyl-L-histidine is a complex peptide with the CAS number 928006-50-2. It is composed of five amino acids: L-glutamine, L-aspartic acid, L-valine, and L-histidine with an acetyl group attached to the N-terminal glutamine. This compound is water-soluble and has a specific molecular structure which makes it suitable for various applications in pharmaceutical and research fields.

About

English Name N~2~-Acetyl-L-glutaminyl-L-alpha-aspartyl-L-valyl-L-histidine
Molecular Formula C22H33N7O9
Molecular Weight 539.55 g/mol
SMILES CC(C)[C@@H](C(=O)N[C@@H](Cc1cnc[nH]1)C(=O)O)NC(=O)[C@H](CC(=O)O)NC(=O)[C@H](CCC(=O)N)NC(=O)C
InChIKey QNZANUZIBYJBIN-XSWJXKHESA-N
Last Updated: 2025-10-12 11:11

Related Q&A

Compound Q&A

What are the main uses of N~2~-Acetyl-L-glutaminyl-L-alpha-aspartyl-L-valyl-L-histidine (CAS: 928006-50-2)?

N~2~-Acetyl-L-glutaminyl-L-alpha-aspartyl-L-valyl-L-histidine is primarily used in pharmaceuticals f...

Compound Q&A

Is N~2~-Acetyl-L-glutaminyl-L-alpha-aspartyl-L-valyl-L-histidine (CAS: 928006-50-2) safe?

N~2~-Acetyl-L-glutaminyl-L-alpha-aspartyl-L-valyl-L-histidine (CAS: 928006-50-2) is generally consid...

Compound Q&A

How should N~2~-Acetyl-L-glutaminyl-L-alpha-aspartyl-L-valyl-L-histidine (CAS: 928006-50-2) be stored?

N~2~-Acetyl-L-glutaminyl-L-alpha-aspartyl-L-valyl-L-histidine should be stored in a tightly sealed c...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...