Compound Q&A

How should 1,3-Benzothiazole-5-carboxylic acid (CAS: 68867-17-4) be stored?

Answer

1,3-Benzothiazole-5-carboxylic acid
1,3-Benzothiazole-5-carboxylic acid should be stored in a tightly sealed container in a cool, dry place away from direct sunlight and moisture. Maintain a temperature range of 15-25°C and store it in a well-ventilated area to prevent the risk of heat-induced decomposition.

About

CAS No 68867-17-4
English Name 1,3-Benzothiazole-5-carboxylic acid
Molecular Formula C8H5NO2S
Molecular Weight 179.2 g/mol
SMILES C1=CC2=C(C=C1C(=O)O)N=CS2
InChIKey RBIZQDIIVYJNRS-UHFFFAOYSA-N
Last Updated: 2025-10-12 11:11

Related Q&A

Compound Q&A

What is 1,3-Benzothiazole-5-carboxylic acid (CAS: 68867-17-4)?

1,3-Benzothiazole-5-carboxylic acid is a heterocyclic organic compound with the CAS number 68867-17-...

Compound Q&A

What are the main uses of 1,3-Benzothiazole-5-carboxylic acid (CAS: 68867-17-4)?

1,3-Benzothiazole-5-carboxylic acid is primarily used in the pharmaceutical industry as a precursor ...

Compound Q&A

Is 1,3-Benzothiazole-5-carboxylic acid (CAS: 68867-17-4) safe?

1,3-Benzothiazole-5-carboxylic acid is generally considered safe for handling when appropriate preca...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...