Compound Q&A

How should 3-(2,2-Dichlorovinyl)-2,2-dimethylcyclopropanecarbonyl chloride (CAS: 52314-67-7) be stored?

Answer

3-(2,2-Dichlorovinyl)-2,2-dimethylcyclopropanecarbonyl chloride
3-(2,2-Dichlorovinyl)-2,2-dimethylcyclopropanecarbonyl chloride should be stored in a cool, dry place away from direct sunlight and sources of heat to prevent degradation. It should be kept in a sealed container to minimize exposure to air and moisture. Additionally, it is advisable to store it in a well-ventilated area to ensure proper dispersion of any volatile compounds.

About

CAS No 52314-67-7
English Name 3-(2,2-Dichlorovinyl)-2,2-dimethylcyclopropanecarbonyl chloride
Molecular Formula C8H9Cl3O
Molecular Weight 227.52 g/mol
SMILES CC1(C(C1C(=O)Cl)C=C(Cl)Cl)C
InChIKey CHLAOFANYRDCPD-UHFFFAOYSA-N
Last Updated: 2025-10-12 11:11

Related Q&A

Compound Q&A

What is 3-(2,2-Dichlorovinyl)-2,2-dimethylcyclopropanecarbonyl chloride (CAS: 52314-67-7)?

3-(2,2-Dichlorovinyl)-2,2-dimethylcyclopropanecarbonyl chloride is an organic compound with the CAS ...

Compound Q&A

What are the main uses of 3-(2,2-Dichlorovinyl)-2,2-dimethylcyclopropanecarbonyl chloride (CAS: 52314-67-7)?

3-(2,2-Dichlorovinyl)-2,2-dimethylcyclopropanecarbonyl chloride is primarily used in the pharmaceuti...

Compound Q&A

Is 3-(2,2-Dichlorovinyl)-2,2-dimethylcyclopropanecarbonyl chloride (CAS: 52314-67-7) safe?

3-(2,2-Dichlorovinyl)-2,2-dimethylcyclopropanecarbonyl chloride (CAS: 52314-67-7) is generally consi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...