Compound Q&A

Are there alternatives to Ferroceneboronic acid (CAS: 12152-94-2) in synthesis?

Answer

Ferroceneboronic acid
There are several alternatives to Ferroceneboronic acid (CAS: 12152-94-2) in synthesis, such as other boronic acids or related organometallic compounds. These alternatives can provide similar reactivity and functional groups for various synthetic applications, depending on the specific requirements of the reaction and the desired product properties.

About

CAS No 12152-94-2
English Name Ferroceneboronic acid
Molecular Formula C10H11BFeO2
Molecular Weight 229.85 g/mol
EINECS 235-272-1
SMILES OB(O)[C-]12[Fe+2]3456789([C-]%10C6=C7C8=C9%10)C1=C3C4=C25
InChIKey HHGAJIKAUQWFKH-UHFFFAOYSA-N
Last Updated: 2025-10-11 22:33

Related Q&A

Compound Q&A

What regulatory guidelines apply to Ferroceneboronic acid (CAS: 12152-94-2)?

Ferroceneboronic acid (CAS: 12152-94-2) is classified under the Globally Harmonized System of Classi...

Compound Q&A

What is the market or research trend for Ferroceneboronic acid (CAS: 12152-94-2)?

The market for Ferroceneboronic acid (CAS: 12152-94-2) is growing due to its applications in catalys...

Compound Q&A

How should waste containing Ferroceneboronic acid (CAS: 12152-94-2) be handled?

Waste containing Ferroceneboronic acid (CAS: 12152-94-2) should be collected in appropriate containe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...