Compound Q&A

What are the physical and chemical properties of 1,3-Diethoxy-1,1,3,3-tetramethyldisiloxane (CAS: 18420-09-2)?

Answer

1,3-Diethoxy-1,1,3,3-tetramethyldisiloxane
1,3-Diethoxy-1,1,3,3-tetramethyldisiloxane is a colorless, viscous liquid with a high boiling point and low volatility. It has a molecular weight of approximately 306.4 g/mol. The compound is soluble in common organic solvents but has limited water solubility. Chemically, it is less reactive compared to other organosilicon compounds, but it can undergo hydrolysis under acidic conditions. It is used as a stabilizer and as a coupling agent in various applications.

About

CAS No 18420-09-2
English Name 1,3-Diethoxy-1,1,3,3-tetramethyldisiloxane
Molecular Formula C8H22O3Si2
Molecular Weight 222.43 g/mol
SMILES CCO[Si](C)(C)O[Si](C)(C)OCC
InChIKey NPOYZXWZANURMM-UHFFFAOYSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

How is 1,3-Diethoxy-1,1,3,3-tetramethyldisiloxane (CAS: 18420-09-2) typically synthesized?

1,3-Diethoxy-1,1,3,3-tetramethyldisiloxane is typically synthesized through the reaction of tetramet...

Compound Q&A

What industries use 1,3-Diethoxy-1,1,3,3-tetramethyldisiloxane (CAS: 18420-09-2)?

1,3-Diethoxy-1,1,3,3-tetramethyldisiloxane is utilized in various industries. It is commonly used as...

Compound Q&A

What precautions should be taken when handling 1,3-Diethoxy-1,1,3,3-tetramethyldisiloxane (CAS: 18420-09-2)?

When handling 1,3-Diethoxy-1,1,3,3-tetramethyldisiloxane, it is important to use personal protective...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...