Compound Q&A

What industries use Disodium 1,3-benzenedisulfonate (CAS: 831-59-4)?

Answer

Disodium 1,3-benzenedisulfonate
Disodium 1,3-benzenedisulfonate (CAS: 831-59-4) is utilized in various industries. It is commonly used in the pharmaceutical industry for the synthesis of certain drugs, as well as in the polymer industry for plastic additives. Additionally, it has applications in sensors for detecting specific chemical species and in the semiconductor industry for etching and cleaning processes.

About

CAS No 831-59-4
English Name Disodium 1,3-benzenedisulfonate
Molecular Formula C6H4Na2O6S2
Molecular Weight 282.2 g/mol
SMILES C1=CC(=CC(=C1)S(=O)(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+]
InChIKey XWPWZOJBTOJEGW-UHFFFAOYSA-L
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of Disodium 1,3-benzenedisulfonate (CAS: 831-59-4)?

Disodium 1,3-benzenedisulfonate (CAS: 831-59-4) is a crystalline solid with a molecular weight of ap...

Compound Q&A

How is Disodium 1,3-benzenedisulfonate (CAS: 831-59-4) typically synthesized?

Disodium 1,3-benzenedisulfonate (CAS: 831-59-4) is typically synthesized by the sulfonation of benze...

Compound Q&A

What precautions should be taken when handling Disodium 1,3-benzenedisulfonate (CAS: 831-59-4)?

When handling Disodium 1,3-benzenedisulfonate (CAS: 831-59-4), it is essential to wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...