Compound Q&A

What precautions should be taken when handling 4,4',4''-Methanetriyltribenzonitrile (CAS: 113402-31-6)?

Answer

4,4',4''-Methanetriyltribenzonitrile
When handling 4,4',4''-Methanetriyltribenzonitrile, it is essential to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or a fume hood to minimize exposure. Spills should be cleaned up using appropriate absorbent materials, and the area should be thoroughly washed. Always refer to the safety data sheet (SDS) for detailed handling and emergency procedures.

About

English Name 4,4',4''-Methanetriyltribenzonitrile
Molecular Formula C22H13N3
Molecular Weight 319.4 g/mol
SMILES C1=CC(=CC=C1C#N)C(C2=CC=C(C=C2)C#N)C3=CC=C(C=C3)C#N
InChIKey NIJQDIWAJCTWAB-UHFFFAOYSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4,4',4''-Methanetriyltribenzonitrile (CAS: 113402-31-6)?

4,4',4''-Methanetriyltribenzonitrile is a white crystalline solid with a molecular weight of approxi...

Compound Q&A

How is 4,4',4''-Methanetriyltribenzonitrile (CAS: 113402-31-6) typically synthesized?

4,4',4''-Methanetriyltribenzonitrile is typically synthesized through the nitrilation of 4,4',4''-me...

Compound Q&A

What industries use 4,4',4''-Methanetriyltribenzonitrile (CAS: 113402-31-6)?

4,4',4''-Methanetriyltribenzonitrile (CAS: 113402-31-6) is primarily used in the synthesis of dyes a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...