Compound Q&A

What are the physical and chemical properties of 1,1'-Binaphthalene-2,2'-diamine (CAS: 18741-85-0)?

Answer

1,1'-Binaphthalene-2,2'-diamine
1,1'-Binaphthalene-2,2'-diamine is a white crystalline solid with a molecular weight of approximately 268.26 g/mol. It has a low solubility in water but is more soluble in organic solvents like ethanol and acetone. The compound is known for its stability in air and at room temperature. It exhibits mild reactivity towards electrophiles and is often used in the synthesis of other organic compounds.

About

CAS No 18741-85-0
English Name 1,1'-Binaphthalene-2,2'-diamine
Molecular Formula C20H16N2
Molecular Weight 284.36 g/mol
SMILES C1=CC=C2C(=C1)C=CC(=C2C3=C(C=CC4=CC=CC=C43)N)N
InChIKey DDAPSNKEOHDLKB-UHFFFAOYSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

How is 1,1'-Binaphthalene-2,2'-diamine (CAS: 18741-85-0) typically synthesized?

1,1'-Binaphthalene-2,2'-diamine is typically synthesized via the reduction of 1,1'-binaphthalenedion...

Compound Q&A

What industries use 1,1'-Binaphthalene-2,2'-diamine (CAS: 18741-85-0)?

1,1'-Binaphthalene-2,2'-diamine is used in various industries, including pharmaceuticals, where it s...

Compound Q&A

What precautions should be taken when handling 1,1'-Binaphthalene-2,2'-diamine (CAS: 18741-85-0)?

When handling 1,1'-Binaphthalene-2,2'-diamine, it is essential to wear appropriate personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...