Compound Q&A

What industries use Tert-butyl 2,6-diazaspiro[3.4]octane-6-carboxylate (CAS: 885270-86-0)?

Answer

Tert-butyl 2,6-diazaspiro[3.4]octane-6-carboxylate
Tert-butyl 2,6-diazaspiro[3.4]octane-6-carboxylate is used in various industries, including pharmaceuticals, where it acts as a precursor for the synthesis of certain drugs. It is also utilized in polymer chemistry for the modification of polymer properties. Additionally, it has applications in the production of sensors and semiconductors.

About

English Name Tert-butyl 2,6-diazaspiro[3.4]octane-6-carboxylate
Molecular Formula C11H20N2O2
Molecular Weight 212.29 g/mol
SMILES CC(C)(C)OC(=O)N1CCC2(C1)CNC2
InChIKey BGUYAMZPJMTFRU-UHFFFAOYSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of Tert-butyl 2,6-diazaspiro[3.4]octane-6-carboxylate (CAS: 885270-86-0)?

Tert-butyl 2,6-diazaspiro[3.4]octane-6-carboxylate has a crystalline form with a molecular weight of...

Compound Q&A

How is Tert-butyl 2,6-diazaspiro[3.4]octane-6-carboxylate (CAS: 885270-86-0) typically synthesized?

Tert-butyl 2,6-diazaspiro[3.4]octane-6-carboxylate is typically synthesized via the esterification o...

Compound Q&A

What precautions should be taken when handling Tert-butyl 2,6-diazaspiro[3.4]octane-6-carboxylate (CAS: 885270-86-0)?

When handling Tert-butyl 2,6-diazaspiro[3.4]octane-6-carboxylate, it is important to wear appropriat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...