Compound Q&A

What industries use N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-4-nitro-D-phenylalanine (CAS: 61280-75-9)?

Answer

N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-4-nitro-D-phenylalanine
N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-4-nitro-D-phenylalanine is primarily used in the pharmaceutical industry for the synthesis of certain peptide-based drugs. It is also employed in the development of sensors for detecting specific biomolecules and has potential applications in the field of polymer chemistry for the synthesis of novel materials.

About

CAS No 61280-75-9
English Name N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-4-nitro-D-phenylalanine
Molecular Formula C14H18N2O6
Molecular Weight 310.3 g/mol
SMILES CC(C)(C)OC(=O)NC(CC1=CC=C(C=C1)[N+](=O)[O-])C(=O)O
InChIKey XBQADBXCNQPHHY-LLVKDONJSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-4-nitro-D-phenylalanine (CAS: 61280-75-9)?

N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-4-nitro-D-phenylalanine is a crystalline compound with a mole...

Compound Q&A

How is N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-4-nitro-D-phenylalanine (CAS: 61280-75-9) typically synthesized?

N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-4-nitro-D-phenylalanine is synthesized by a multi-step proces...

Compound Q&A

What precautions should be taken when handling N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-4-nitro-D-phenylalanine (CAS: 61280-75-9)?

When handling N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-4-nitro-D-phenylalanine, it is important to wea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...