Compound Q&A

What precautions should be taken when handling 5-Bromo-2-(trifluoromethyl)pyrimidine (CAS: 799557-86-1)?

Answer

5-Bromo-2-(trifluoromethyl)pyrimidine
Proper handling of 5-Bromo-2-(trifluoromethyl)pyrimidine requires the use of personal protective equipment (PPE) such as gloves, goggles, and a lab coat. It should be handled in a well-ventilated area or within a fume hood to minimize exposure to vapors. In case of a spill, it should be wiped up with a suitable absorbent material and the area should be cleaned with water. Always refer to the safety data sheet (SDS) for detailed handling instructions and emergency procedures.

About

English Name 5-Bromo-2-(trifluoromethyl)pyrimidine
Molecular Formula C5H2BrF3N2
Molecular Weight 226.98 g/mol
SMILES C1=C(C=NC(=N1)C(F)(F)F)Br
InChIKey GIFDWXWNFKZVEI-UHFFFAOYSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Bromo-2-(trifluoromethyl)pyrimidine (CAS: 799557-86-1)?

5-Bromo-2-(trifluoromethyl)pyrimidine is a white crystalline solid with a molecular weight of approx...

Compound Q&A

How is 5-Bromo-2-(trifluoromethyl)pyrimidine (CAS: 799557-86-1) typically synthesized?

5-Bromo-2-(trifluoromethyl)pyrimidine can be synthesized by bromination of 2-(trifluoromethyl)pyrimi...

Compound Q&A

What industries use 5-Bromo-2-(trifluoromethyl)pyrimidine (CAS: 799557-86-1)?

5-Bromo-2-(trifluoromethyl)pyrimidine is primarily used in pharmaceutical research for its potential...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...