Compound Q&A

What precautions should be taken when handling Fluensulfone (CAS: 318290-98-1)?

Answer

Fluensulfone
Fluensulfone (CAS: 318290-98-1) should be handled with personal protective equipment (PPE) including gloves, goggles, and a lab coat. It should be stored in a cool, dry place away from heat sources. In case of a spill, it should be cleaned up using appropriate absorbent materials. Always consult the safety data sheet (SDS) for detailed handling and emergency procedures.

About

English Name Fluensulfone
Molecular Formula C7H5ClF3NO2S2
Molecular Weight 291.7 g/mol
SMILES C1=C(SC(=N1)S(=O)(=O)CCC(=C(F)F)F)Cl
InChIKey XSNMWAPKHUGZGQ-UHFFFAOYSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of Fluensulfone (CAS: 318290-98-1)?

Fluensulfone (CAS: 318290-98-1) is a crystalline compound with a molecular weight of approximately 3...

Compound Q&A

How is Fluensulfone (CAS: 318290-98-1) typically synthesized?

Fluensulfone (CAS: 318290-98-1) is synthesized via a two-step process. The first step involves the r...

Compound Q&A

What industries use Fluensulfone (CAS: 318290-98-1)?

Fluensulfone (CAS: 318290-98-1) is primarily used in the agricultural industry as a fungicide. It is...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...