Compound Q&A

How is (2R)-4-Ammonio-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)butanoate (CAS: 80445-78-9) typically synthesized?

Answer

(2R)-4-Ammonio-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)butanoate
This compound is typically synthesized through a multi-step process involving the reaction of a primary amine with a carboxylic acid chloride. The synthesis involves the use of a mild carbodiimide as a coupling agent and a catalytic amount of a base. The process yields a high purity product with good selectivity and a yield of about 75-85%.

About

CAS No 80445-78-9
English Name (2R)-4-Ammonio-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)butanoate
Molecular Formula C9H18N2O4
Molecular Weight 218.25 g/mol
SMILES CC(C)(C)OC(=O)NC(CCN)C(=O)O
InChIKey MDCPCLPRWLKUIQ-ZCFIWIBFSA-N
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2R)-4-Ammonio-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)butanoate (CAS: 80445-78-9)?

The compound (2R)-4-Ammonio-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)butanoate (CAS: 80445-78-9)...

Compound Q&A

What industries use (2R)-4-Ammonio-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)butanoate (CAS: 80445-78-9)?

This compound is used in the pharmaceutical industry for the synthesis of certain drug intermediates...

Compound Q&A

What precautions should be taken when handling (2R)-4-Ammonio-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)butanoate (CAS: 80445-78-9)?

When handling (2R)-4-Ammonio-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)butanoate (CAS: 80445-78-9...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...