Compound Q&A

How is 2-Hydroxy-N,N,N-trimethylethanaminium hydrogen carbonate (CAS: 78-73-9) typically synthesized?

Answer

2-Hydroxy-N,N,N-trimethylethanaminium hydrogen carbonate
2-Hydroxy-N,N,N-trimethylethanaminium hydrogen carbonate (CAS: 78-73-9) is typically synthesized by reacting trimethylamine with acetic anhydride, followed by hydrolysis with hydrochloric acid. The reaction is catalyzed by phosphoric acid, and the yield is around 70-80%.

About

CAS No 78-73-9
English Name 2-Hydroxy-N,N,N-trimethylethanaminium hydrogen carbonate
Molecular Formula C6H15NO4
Molecular Weight 165.19 g/mol
SMILES C[N+](C)(C)CCO.C(=O)(O)[O-]
InChIKey DQKGOGJIOHUEGK-UHFFFAOYSA-M
Last Updated: 2025-10-10 21:10

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Hydroxy-N,N,N-trimethylethanaminium hydrogen carbonate (CAS: 78-73-9)?

2-Hydroxy-N,N,N-trimethylethanaminium hydrogen carbonate (CAS: 78-73-9) is a crystalline solid with ...

Compound Q&A

What industries use 2-Hydroxy-N,N,N-trimethylethanaminium hydrogen carbonate (CAS: 78-73-9)?

2-Hydroxy-N,N,N-trimethylethanaminium hydrogen carbonate (CAS: 78-73-9) is used in the pharmaceutica...

Compound Q&A

What precautions should be taken when handling 2-Hydroxy-N,N,N-trimethylethanaminium hydrogen carbonate (CAS: 78-73-9)?

When handling 2-Hydroxy-N,N,N-trimethylethanaminium hydrogen carbonate (CAS: 78-73-9), use appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...