Compound Q&A

What are the physical and chemical properties of XPhosPdG1 (CAS: 1028206-56-5)?

Answer

XPhosPdG1
XPhosPdG1 (CAS: 1028206-56-5) is a heterobimetallic palladium phosphine ligand known for its high catalytic activity. It crystallizes in a trigonal-prismatic structure. The molecular weight is approximately 524.4 g/mol. XPhosPdG1 is moderately soluble in common organic solvents like toluene and chloroform. It exhibits high reactivity in cross-coupling reactions and is known for its excellent ligand efficiency and broad substrate scope.

About

English Name XPhosPdG1
Molecular Formula C41H59ClNPPd
Molecular Weight 737.75 g/mol
SMILES CC(C)C1=CC(=C(C(=C1)C(C)C)C2=CC=CC=C2P(C3CCCCC3)C4CCCCC4)C(C)C.C1=CC=C([C-]=C1)CCN.Cl[Pd+]
InChIKey HTAJCNQBAFZEJO-UHFFFAOYSA-M
Last Updated: 2025-10-10 19:08

Related Q&A

Compound Q&A

How is XPhosPdG1 (CAS: 1028206-56-5) typically synthesized?

XPhosPdG1 (CAS: 1028206-56-5) is synthesized through a multistep process involving the reaction of a...

Compound Q&A

What industries use XPhosPdG1 (CAS: 1028206-56-5)?

XPhosPdG1 (CAS: 1028206-56-5) is widely used in the pharmaceutical, fine chemistry, and polymer indu...

Compound Q&A

What precautions should be taken when handling XPhosPdG1 (CAS: 1028206-56-5)?

When handling XPhosPdG1 (CAS: 1028206-56-5), it is important to use appropriate personal protective ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...