Compound Q&A

What are the physical and chemical properties of 4-(Benzyloxy)phenethyl decanoate (CAS: 848484-93-5)?

Answer

4-(Benzyloxy)phenethyl decanoate
4-(Benzyloxy)phenethyl decanoate is a crystalline compound with a molecular weight of approximately 314.35 g/mol. It has a low solubility in water but is soluble in organic solvents like ethanol and acetone. The compound is relatively stable under normal conditions but can react with strong bases. It has a melting point of around 65-67°C.

About

English Name 4-(Benzyloxy)phenethyl decanoate
Molecular Formula C25H34O3
Molecular Weight 382.54 g/mol
SMILES CCCCCCCCCC(=O)OC(c1ccc(cc1)OCc1ccccc1)C
InChIKey TYNKIFVKBNHITE-UHFFFAOYSA-N
Last Updated: 2025-10-10 19:08

Related Q&A

Compound Q&A

How is 4-(Benzyloxy)phenethyl decanoate (CAS: 848484-93-5) typically synthesized?

4-(Benzyloxy)phenethyl decanoate is typically synthesized through esterification of benzyloxypheneth...

Compound Q&A

What industries use 4-(Benzyloxy)phenethyl decanoate (CAS: 848484-93-5)?

4-(Benzyloxy)phenethyl decanoate is used in the fragrance and flavor industry due to its pleasant ar...

Compound Q&A

What precautions should be taken when handling 4-(Benzyloxy)phenethyl decanoate (CAS: 848484-93-5)?

When handling 4-(Benzyloxy)phenethyl decanoate, it is important to use appropriate personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...