Compound Q&A

What industries use 2-Nitrophenyl beta-D-xylopyranoside (CAS: 10238-27-4)?

Answer

2-Nitrophenyl beta-D-xylopyranoside
2-Nitrophenyl beta-D-xylopyranoside is utilized in the pharmaceutical industry for the synthesis of certain intermediates and drugs. It is also of interest in analytical chemistry and sensor technology due to its specific reactivity and structural characteristics. Additionally, this compound can be used in the development of new materials and in academic research for studying carbohydrate chemistry.

About

CAS No 10238-27-4
English Name 2-Nitrophenyl beta-D-xylopyranoside
Molecular Formula C11H13NO7
Molecular Weight 271.22 g/mol
SMILES C1C(C(C(C(O1)OC2=CC=CC=C2[N+](=O)[O-])O)O)O
InChIKey YPQCLGUTGDQYNI-DQDDRIPDSA-N
Last Updated: 2025-10-10 19:08

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Nitrophenyl beta-D-xylopyranoside (CAS: 10238-27-4)?

2-Nitrophenyl beta-D-xylopyranoside is a crystalline compound with a molecular weight of approximate...

Compound Q&A

How is 2-Nitrophenyl beta-D-xylopyranoside (CAS: 10238-27-4) typically synthesized?

2-Nitrophenyl beta-D-xylopyranoside is commonly synthesized via a condensation reaction between 2-ni...

Compound Q&A

What precautions should be taken when handling 2-Nitrophenyl beta-D-xylopyranoside (CAS: 10238-27-4)?

When handling 2-Nitrophenyl beta-D-xylopyranoside, it is important to wear appropriate personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...