Compound Q&A

What industries use Hirsuteine (CAS: 35467-43-7)?

Answer

Hirsuteine
Hirsuteine (CAS: 35467-43-7) is primarily used in the pharmaceutical industry for its potential as a therapeutic agent. It has shown promise in anti-inflammatory and anti-tumor research. Additionally, it is of interest in the chemical industry for its use as a precursor in the synthesis of other compounds. Research in its application for sensor technology and polymer modification is also ongoing.

About

CAS No 35467-43-7
English Name Hirsuteine
Molecular Formula C22H26N2O3
Molecular Weight 366.46 g/mol
SMILES COC=C(C1CC2C3=C(CCN2CC1C=C)C4=CC=CC=C4N3)C(=O)OC
InChIKey TZUGIFAYWNNSAO-AZQGJTAVSA-N
Last Updated: 2025-10-10 19:08

Related Q&A

Compound Q&A

What are the physical and chemical properties of Hirsuteine (CAS: 35467-43-7)?

Hirsuteine (CAS: 35467-43-7) is a crystalline compound with a molecular weight of approximately 328....

Compound Q&A

How is Hirsuteine (CAS: 35467-43-7) typically synthesized?

Hirsuteine (CAS: 35467-43-7) is typically synthesized through a multi-step process involving alkylat...

Compound Q&A

What precautions should be taken when handling Hirsuteine (CAS: 35467-43-7)?

When handling Hirsuteine (CAS: 35467-43-7), it is essential to wear appropriate personal protective ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...