Compound Q&A

What are the physical and chemical properties of 3,5-Dibromo-2-hydroxybenzoic acid (CAS: 3147-55-5)?

Answer

3,5-Dibromo-2-hydroxybenzoic acid
3,5-Dibromo-2-hydroxybenzoic acid (CAS: 3147-55-5) is a white crystalline solid with a molecular weight of approximately 283.04 g/mol. It has a melting point of around 210°C and is slightly soluble in water. The compound is known for its acidic nature and its reactivity towards bases and reducing agents.

About

CAS No 3147-55-5
English Name 3,5-Dibromo-2-hydroxybenzoic acid
Molecular Formula C7H4Br2O3
Molecular Weight 295.91 g/mol
SMILES C1=C(C=C(C(=C1C(=O)O)O)Br)Br
InChIKey BFBZHSOXKROMBG-UHFFFAOYSA-N
Last Updated: 2025-10-10 19:08

Related Q&A

Compound Q&A

How is 3,5-Dibromo-2-hydroxybenzoic acid (CAS: 3147-55-5) typically synthesized?

3,5-Dibromo-2-hydroxybenzoic acid (CAS: 3147-55-5) is commonly synthesized by brominating 2-hydroxyb...

Compound Q&A

What industries use 3,5-Dibromo-2-hydroxybenzoic acid (CAS: 3147-55-5)?

3,5-Dibromo-2-hydroxybenzoic acid (CAS: 3147-55-5) is used in various industries such as pharmaceuti...

Compound Q&A

What precautions should be taken when handling 3,5-Dibromo-2-hydroxybenzoic acid (CAS: 3147-55-5)?

When handling 3,5-Dibromo-2-hydroxybenzoic acid (CAS: 3147-55-5), it is essential to wear appropriat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...