Compound Q&A

What industries use 2,2,3,3,4,4,5,5,6,6,7,7-Dodecafluoro-1-heptanol (CAS: 335-99-9)?

Answer

2,2,3,3,4,4,5,5,6,6,7,7-Dodecafluoro-1-heptanol
2,2,3,3,4,4,5,5,6,6,7,7-Dodecafluoro-1-heptanol is used in various industries. It is primarily used in the pharmaceutical industry for the synthesis of fluorochemical compounds and as a solvent. In the polymer industry, it serves as a monomer for fluoroelastomers. Additionally, it finds applications in the production of fluorinated surfactants, semiconductors, and as a component in sensor technologies. Its unique properties make it valuable in these fields.

About

CAS No 335-99-9
English Name 2,2,3,3,4,4,5,5,6,6,7,7-Dodecafluoro-1-heptanol
Molecular Formula C7H4F12O
Molecular Weight 332.08 g/mol
SMILES C(C(C(C(C(C(C(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)O
InChIKey BYKNGMLDSIEFFG-UHFFFAOYSA-N
Last Updated: 2025-10-10 19:08

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,2,3,3,4,4,5,5,6,6,7,7-Dodecafluoro-1-heptanol (CAS: 335-99-9)?

2,2,3,3,4,4,5,5,6,6,7,7-Dodecafluoro-1-heptanol is a colorless liquid with a high boiling point of 2...

Compound Q&A

How is 2,2,3,3,4,4,5,5,6,6,7,7-Dodecafluoro-1-heptanol (CAS: 335-99-9) typically synthesized?

2,2,3,3,4,4,5,5,6,6,7,7-Dodecafluoro-1-heptanol is typically synthesized via the reduction of 2,2,3,...

Compound Q&A

What precautions should be taken when handling 2,2,3,3,4,4,5,5,6,6,7,7-Dodecafluoro-1-heptanol (CAS: 335-99-9)?

When handling 2,2,3,3,4,4,5,5,6,6,7,7-Dodecafluoro-1-heptanol, it is important to use personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...