Compound Q&A

How is Fosaprepitant (CAS: 172673-20-0) typically synthesized?

Answer

Fosaprepitant
Fosaprepitant is synthesized through a multi-step process involving the use of Grignard reagents and Suzuki coupling reactions. The key steps include the formation of ester intermediates and the reduction of the ester to the corresponding alcohol. The final step involves the conversion to the prodrug form. The synthesis typically achieves high yields and high selectivity, making it suitable for pharmaceutical production.

About

English Name Fosaprepitant
Molecular Formula C23H22F7N4O6P
Molecular Weight 614.4 g/mol
SMILES CC(C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)OC2C(N(CCO2)CC3=NN(C(=O)N3)P(=O)(O)O)C4=CC=C(C=C4)F
InChIKey BARDROPHSZEBKC-OITMNORJSA-N
Last Updated: 2025-10-10 19:08

Related Q&A

Compound Q&A

What are the physical and chemical properties of Fosaprepitant (CAS: 172673-20-0)?

Fosaprepitant (CAS: 172673-20-0) is a white to off-white crystalline powder with a molecular weight ...

Compound Q&A

What industries use Fosaprepitant (CAS: 172673-20-0)?

Fosaprepitant (CAS: 172673-20-0) is primarily used in the pharmaceutical industry. It is an importan...

Compound Q&A

What precautions should be taken when handling Fosaprepitant (CAS: 172673-20-0)?

When handling Fosaprepitant (CAS: 172673-20-0), it is essential to wear appropriate personal protect...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...