Compound Q&A

What are the physical and chemical properties of N,N,N,N',N',N'-Hexamethyl-1,6-hexanediaminium dihydroxide (CAS: 556-81-0)?

Answer

N,N,N,N',N',N'-Hexamethyl-1,6-hexanediaminium dihydroxide
N,N,N,N',N',N'-Hexamethyl-1,6-hexanediaminium dihydroxide is a crystalline compound with a molecular weight of approximately 232.24 g/mol. It has a low solubility in water and exhibits basic reactivity. This compound is highly stable but can react with acids to form salts. It is typically found in a solid form at room temperature and has a melting point around 100°C.

About

CAS No 556-81-0
English Name N,N,N,N',N',N'-Hexamethyl-1,6-hexanediaminium dihydroxide
Molecular Formula C12H32N2O2
Molecular Weight 236.39 g/mol
SMILES C[N+](C)(C)CCCCCC[N+](C)(C)C.[OH-].[OH-]
InChIKey GYLUMIIRFKDCKI-UHFFFAOYSA-L
Last Updated: 2025-10-10 19:08

Related Q&A

Compound Q&A

How is N,N,N,N',N',N'-Hexamethyl-1,6-hexanediaminium dihydroxide (CAS: 556-81-0) typically synthesized?

N,N,N,N',N',N'-Hexamethyl-1,6-hexanediaminium dihydroxide can be synthesized via the condensation of...

Compound Q&A

What industries use N,N,N,N',N',N'-Hexamethyl-1,6-hexanediaminium dihydroxide (CAS: 556-81-0)?

N,N,N,N',N',N'-Hexamethyl-1,6-hexanediaminium dihydroxide finds applications in various industries, ...

Compound Q&A

What precautions should be taken when handling N,N,N,N',N',N'-Hexamethyl-1,6-hexanediaminium dihydroxide (CAS: 556-81-0)?

When handling N,N,N,N',N',N'-Hexamethyl-1,6-hexanediaminium dihydroxide, it is crucial to wear appro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...