Compound Q&A

What precautions should be taken when handling 2-Chloroethyl 4-methylbenzenesulfonate (CAS: 80-41-1)?

Answer

2-Chloroethyl 4-methylbenzenesulfonate
When handling 2-Chloroethyl 4-methylbenzenesulfonate (CAS: 80-41-1), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or a fume hood to avoid inhalation of fumes. Spills should be handled with caution, and appropriate safety data sheets (SDS) should be consulted for detailed spill procedures. Ensure proper storage in a cool, dry place, away from incompatible materials.

About

CAS No 80-41-1
English Name 2-Chloroethyl 4-methylbenzenesulfonate
Molecular Formula C9H11ClO3S
Molecular Weight 234.7 g/mol
SMILES CC1=CC=C(C=C1)S(=O)(=O)OCCCl
InChIKey ZXNMIUJDTOMBPV-UHFFFAOYSA-N
Last Updated: 2025-10-10 19:08

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Chloroethyl 4-methylbenzenesulfonate (CAS: 80-41-1)?

2-Chloroethyl 4-methylbenzenesulfonate (CAS: 80-41-1) is a crystalline solid with a molecular weight...

Compound Q&A

How is 2-Chloroethyl 4-methylbenzenesulfonate (CAS: 80-41-1) typically synthesized?

2-Chloroethyl 4-methylbenzenesulfonate is typically synthesized through the reaction of 4-methylbenz...

Compound Q&A

What industries use 2-Chloroethyl 4-methylbenzenesulfonate (CAS: 80-41-1)?

2-Chloroethyl 4-methylbenzenesulfonate (CAS: 80-41-1) is used in various industries, including pharm...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...