Compound Q&A

How is (2S,3R)-2-[(Dichloroacetyl)amino]-3-hydroxy-3-[4-(methylsulfonyl)phenyl]propyl glycinate hydrochloride (CAS: 2611-61-2) typically synthesized?

Answer

(2S,3R)-2-[(Dichloroacetyl)amino]-3-hydroxy-3-[4-(methylsulfonyl)phenyl]propyl glycinate hydrochloride (1:1)
It is synthesized from 2-amino-3-hydroxy-3-[4-(methylsulfonyl)phenyl]propionic acid and dichloroacetyl chloride, using a multi-step process involving esterification and amidation reactions. The reaction is typically catalyzed by a suitable base, and the product is isolated and purified by recrystallization or column chromatography.

About

CAS No 2611-61-2
English Name (2S,3R)-2-[(Dichloroacetyl)amino]-3-hydroxy-3-[4-(methylsulfonyl)phenyl]propyl glycinate hydrochloride (1:1)
Molecular Formula C14H19Cl3N2O6S
Molecular Weight 449.74 g/mol
SMILES CS(=O)(=O)C1=CC=C(C=C1)C(C(COC(=O)CN)NC(=O)C(Cl)Cl)O.Cl
InChIKey DKXJDBJNAXSJDH-XOZOLZJESA-N
Last Updated: 2025-10-10 19:08

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2S,3R)-2-[(Dichloroacetyl)amino]-3-hydroxy-3-[4-(methylsulfonyl)phenyl]propyl glycinate hydrochloride (CAS: 2611-61-2)?

The compound (2S,3R)-2-[(Dichloroacetyl)amino]-3-hydroxy-3-[4-(methylsulfonyl)phenyl]propyl glycinat...

Compound Q&A

What industries use (2S,3R)-2-[(Dichloroacetyl)amino]-3-hydroxy-3-[4-(methylsulfonyl)phenyl]propyl glycinate hydrochloride (CAS: 2611-61-2)?

This compound is used in the pharmaceutical industry for the synthesis of certain drugs. It can also...

Compound Q&A

What precautions should be taken when handling (2S,3R)-2-[(Dichloroacetyl)amino]-3-hydroxy-3-[4-(methylsulfonyl)phenyl]propyl glycinate hydrochloride (CAS: 2611-61-2)?

Proper personal protective equipment (PPE) should be worn, including gloves, goggles, and a lab coat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...