Compound Q&A

What are the physical and chemical properties of Benzyl(diphenyl)phosphine (CAS: 7650-91-1)?

Answer

Benzyl(diphenyl)phosphine
Benzyl(diphenyl)phosphine (CAS: 7650-91-1) is a crystalline solid with a molecular weight of approximately 339.23 g/mol. It has limited solubility in water but is soluble in organic solvents like benzene, toluene, and chloroform. This compound is characterized by its low reactivity under normal conditions but can be prone to oxidation and degradation in air and light. Its stability and reactivity make it useful in various chemical reactions.

About

CAS No 7650-91-1
English Name Benzyl(diphenyl)phosphine
Molecular Formula C19H17P
Molecular Weight 276.32 g/mol
SMILES C1=CC=C(C=C1)CP(C2=CC=CC=C2)C3=CC=CC=C3
InChIKey UZCPNEBHTFYJNY-UHFFFAOYSA-N
Last Updated: 2025-10-10 19:08

Related Q&A

Compound Q&A

How is Benzyl(diphenyl)phosphine (CAS: 7650-91-1) typically synthesized?

Benzyl(diphenyl)phosphine (CAS: 7650-91-1) is commonly synthesized via the reaction of phenylphosphi...

Compound Q&A

What industries use Benzyl(diphenyl)phosphine (CAS: 7650-91-1)?

Benzyl(diphenyl)phosphine (CAS: 7650-91-1) is utilized in various industries, particularly in the ph...

Compound Q&A

What precautions should be taken when handling Benzyl(diphenyl)phosphine (CAS: 7650-91-1)?

When handling Benzyl(diphenyl)phosphine (CAS: 7650-91-1), it is essential to wear appropriate person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...