Compound Q&A

How is [2,2'-Bipyridine]-6,6'-dicarboxylic acid (CAS: 4479-74-7) typically synthesized?

Answer

[2,2'-Bipyridine]-6,6'-dicarboxylic acid
[2,2'-Bipyridine]-6,6'-dicarboxylic acid can be synthesized by the condensation of 2,2'-bipyridine with carbon dioxide in the presence of a base. Commonly, this involves the reaction of 2,2'-bipyridine with carbon dioxide in the presence of a catalyst such as p-toluenesulfonic acid at a moderate temperature. The yield is typically high, and the product is isolated by filtration and recrystallization.

About

CAS No 4479-74-7
English Name [2,2'-Bipyridine]-6,6'-dicarboxylic acid
Molecular Formula C12H8N2O4
Molecular Weight 244.21 g/mol
SMILES O=C(C1=CC=CC(C2=NC(C(O)=O)=CC=C2)=N1)O
InChIKey DASAXWLMIWDYLQ-UHFFFAOYSA-N
Last Updated: 2025-10-10 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of [2,2'-Bipyridine]-6,6'-dicarboxylic acid (CAS: 4479-74-7)?

[2,2'-Bipyridine]-6,6'-dicarboxylic acid is a crystalline solid with a molecular weight of approxima...

Compound Q&A

What industries use [2,2'-Bipyridine]-6,6'-dicarboxylic acid (CAS: 4479-74-7)?

[2,2'-Bipyridine]-6,6'-dicarboxylic acid is widely used in various industries. It is an important bu...

Compound Q&A

What precautions should be taken when handling [2,2'-Bipyridine]-6,6'-dicarboxylic acid (CAS: 4479-74-7)?

When handling [2,2'-Bipyridine]-6,6'-dicarboxylic acid, it is important to use appropriate personal ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...