Compound Q&A

How is (2Z)-3-{3-[3,5-Bis(trifluoromethyl)phenyl]-1H-1,2,4-triazol-1-yl}-N'-(2-pyrazinyl)acrylohydrazide (CAS: 1393477-72-9) typically synthesized?

Answer

(2Z)-3-{3-[3,5-Bis(trifluoromethyl)phenyl]-1H-1,2,4-triazol-1-yl}-N'-(2-pyrazinyl)acrylohydrazide
This compound is synthesized through a multi-step process involving the coupling of a pyrazinyl acryloyl chloride with 3-{3-[3,5-bis(trifluoromethyl)phenyl]-1H-1,2,4-triazol-1-yl}hydrazine. The synthesis typically uses triethylamine as a base and requires the use of a suitable solvent like dichloromethane. The overall yield is moderate, around 50-60%, with excellent selectivity.

About

English Name (2Z)-3-{3-[3,5-Bis(trifluoromethyl)phenyl]-1H-1,2,4-triazol-1-yl}-N'-(2-pyrazinyl)acrylohydrazide
Molecular Formula C17H11F6N7O
Molecular Weight 443.31 g/mol
SMILES FC(F)(F)c1cc(cc(c1)C(F)(F)F)c2ncn(/C=C\C(=O)NNc3cnccn3)n2
InChIKey DEVSOMFAQLZNKR-RJRFIUFISA-N
Last Updated: 2025-10-10 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2Z)-3-{3-[3,5-Bis(trifluoromethyl)phenyl]-1H-1,2,4-triazol-1-yl}-N'-(2-pyrazinyl)acrylohydrazide (CAS: 1393477-72-9)?

This compound is a crystalline solid with a molecular weight of approximately 648.3 g/mol. It has li...

Compound Q&A

What industries use (2Z)-3-{3-[3,5-Bis(trifluoromethyl)phenyl]-1H-1,2,4-triazol-1-yl}-N'-(2-pyrazinyl)acrylohydrazide (CAS: 1393477-72-9)?

This compound is primarily used in the pharmaceutical industry as an intermediate in the synthesis o...

Compound Q&A

What precautions should be taken when handling (2Z)-3-{3-[3,5-Bis(trifluoromethyl)phenyl]-1H-1,2,4-triazol-1-yl}-N'-(2-pyrazinyl)acrylohydrazide (CAS: 1393477-72-9)?

When handling this compound, it is essential to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...