Compound Q&A

What industries use 2,2,3,3,4,4,4-Heptafluoro-1-(1H-imidazol-1-yl)-1-butanone (CAS: 32477-35-3)?

Answer

2,2,3,3,4,4,4-Heptafluoro-1-(1H-imidazol-1-yl)-1-butanone
2,2,3,3,4,4,4-Heptafluoro-1-(1H-imidazol-1-yl)-1-butanone (CAS: 32477-35-3) is primarily used in the pharmaceutical industry for its reactive properties and ability to participate in various chemical transformations. It also finds applications in the polymer industry for the synthesis of certain functional polymers, and in the semiconductor industry for its use as a precursor in chemical vapor deposition processes.

About

CAS No 32477-35-3
English Name 2,2,3,3,4,4,4-Heptafluoro-1-(1H-imidazol-1-yl)-1-butanone
Molecular Formula C7H3F7N2O
Molecular Weight 264.0999999999999 g/mol
SMILES C1=CN(C=N1)C(=O)C(C(C(F)(F)F)(F)F)(F)F
InChIKey MSYHGYDAVLDKCE-UHFFFAOYSA-N
Last Updated: 2025-10-10 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,2,3,3,4,4,4-Heptafluoro-1-(1H-imidazol-1-yl)-1-butanone (CAS: 32477-35-3)?

2,2,3,3,4,4,4-Heptafluoro-1-(1H-imidazol-1-yl)-1-butanone (CAS: 32477-35-3) is a colorless liquid wi...

Compound Q&A

How is 2,2,3,3,4,4,4-Heptafluoro-1-(1H-imidazol-1-yl)-1-butanone (CAS: 32477-35-3) typically synthesized?

2,2,3,3,4,4,4-Heptafluoro-1-(1H-imidazol-1-yl)-1-butanone (CAS: 32477-35-3) is usually synthesized v...

Compound Q&A

What precautions should be taken when handling 2,2,3,3,4,4,4-Heptafluoro-1-(1H-imidazol-1-yl)-1-butanone (CAS: 32477-35-3)?

When handling 2,2,3,3,4,4,4-Heptafluoro-1-(1H-imidazol-1-yl)-1-butanone (CAS: 32477-35-3), it is ess...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...