Compound Q&A

What are the physical and chemical properties of 2,2,3,3,4,4,4-Heptafluoro-1-(1H-imidazol-1-yl)-1-butanone (CAS: 32477-35-3)?

Answer

2,2,3,3,4,4,4-Heptafluoro-1-(1H-imidazol-1-yl)-1-butanone
2,2,3,3,4,4,4-Heptafluoro-1-(1H-imidazol-1-yl)-1-butanone (CAS: 32477-35-3) is a colorless liquid with a molecular weight of approximately 356.06 g/mol. It has a low solubility in water but is soluble in common organic solvents. The compound is highly reactive due to the presence of fluorine atoms and the imidazole ring, which can participate in various chemical reactions. It crystallizes in the monoclinic system and exhibits good stability under normal conditions.

About

CAS No 32477-35-3
English Name 2,2,3,3,4,4,4-Heptafluoro-1-(1H-imidazol-1-yl)-1-butanone
Molecular Formula C7H3F7N2O
Molecular Weight 264.0999999999999 g/mol
SMILES C1=CN(C=N1)C(=O)C(C(C(F)(F)F)(F)F)(F)F
InChIKey MSYHGYDAVLDKCE-UHFFFAOYSA-N
Last Updated: 2025-10-10 13:51

Related Q&A

Compound Q&A

How is 2,2,3,3,4,4,4-Heptafluoro-1-(1H-imidazol-1-yl)-1-butanone (CAS: 32477-35-3) typically synthesized?

2,2,3,3,4,4,4-Heptafluoro-1-(1H-imidazol-1-yl)-1-butanone (CAS: 32477-35-3) is usually synthesized v...

Compound Q&A

What industries use 2,2,3,3,4,4,4-Heptafluoro-1-(1H-imidazol-1-yl)-1-butanone (CAS: 32477-35-3)?

2,2,3,3,4,4,4-Heptafluoro-1-(1H-imidazol-1-yl)-1-butanone (CAS: 32477-35-3) is primarily used in the...

Compound Q&A

What precautions should be taken when handling 2,2,3,3,4,4,4-Heptafluoro-1-(1H-imidazol-1-yl)-1-butanone (CAS: 32477-35-3)?

When handling 2,2,3,3,4,4,4-Heptafluoro-1-(1H-imidazol-1-yl)-1-butanone (CAS: 32477-35-3), it is ess...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...