Compound Q&A

How is N-Benzyl-linoleamide (CAS: 18286-71-0) typically synthesized?

Answer

N-Benzyl-linoleamide
N-Benzyl-linoleamide is typically synthesized by the reaction of benzylamine with linoleic acid in the presence of a catalyst such as a strong acid like trifluoroacetic acid (TFA). The synthesis involves esterification followed by the formation of the amide bond. The process yields a high degree of selectivity for the intended product with a yield of around 90%. The reaction is performed under mild conditions to avoid degradation of the amide product.

About

CAS No 18286-71-0
English Name N-Benzyl-linoleamide
Molecular Formula C25H39NO
Molecular Weight 369.59 g/mol
SMILES CCCCCC=CCC=CCCCCCCCC(=O)NCC1=CC=CC=C1
InChIKey YJWLCIANOBCQGW-HZJYTTRNSA-N
Last Updated: 2025-10-10 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of N-Benzyl-linoleamide (CAS: 18286-71-0)?

N-Benzyl-linoleamide (CAS: 18286-71-0) is a white to pale yellow crystalline solid. Its molecular we...

Compound Q&A

What industries use N-Benzyl-linoleamide (CAS: 18286-71-0)?

N-Benzyl-linoleamide (CAS: 18286-71-0) is used in the pharmaceutical industry as a precursor for the...

Compound Q&A

What precautions should be taken when handling N-Benzyl-linoleamide (CAS: 18286-71-0)?

When handling N-Benzyl-linoleamide (CAS: 18286-71-0), it is important to wear appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...