Compound Q&A

How is 5-Bromo-2-thiophenesulfonamide (CAS: 53595-65-6) typically synthesized?

Answer

5-Bromo-2-thiophenesulfonamide
5-Bromo-2-thiophenesulfonamide (CAS: 53595-65-6) is typically synthesized through a bromination reaction of 2-thiophenesulfonamide. The reaction involves the use of bromine in the presence of a base such as sodium hydroxide. The yield is generally good, with selectivity towards the brominated product. The reaction conditions and catalysts used can affect the purity and yield of the final product.

About

CAS No 53595-65-6
English Name 5-Bromo-2-thiophenesulfonamide
Molecular Formula C4H4BrNO2S2
Molecular Weight 242.12 g/mol
SMILES C1=C(SC(=C1)Br)S(=O)(=O)N
InChIKey WXJQQLDICAOBJB-UHFFFAOYSA-N
Last Updated: 2025-10-10 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Bromo-2-thiophenesulfonamide (CAS: 53595-65-6)?

5-Bromo-2-thiophenesulfonamide (CAS: 53595-65-6) is a white crystalline solid with a molecular weigh...

Compound Q&A

What industries use 5-Bromo-2-thiophenesulfonamide (CAS: 53595-65-6)?

5-Bromo-2-thiophenesulfonamide (CAS: 53595-65-6) finds applications in various industries, particula...

Compound Q&A

What precautions should be taken when handling 5-Bromo-2-thiophenesulfonamide (CAS: 53595-65-6)?

When handling 5-Bromo-2-thiophenesulfonamide (CAS: 53595-65-6), it is important to wear appropriate ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...