Compound Q&A

How is 4-Iodo-benzenesulfonic acid potassium-salt (CAS: 13035-63-7) typically synthesized?

Answer

4-Iodo-benzenesulfonic acid potassium-salt
4-Iodo-benzenesulfonic acid potassium-salt is typically synthesized by reacting 4-iodobenzenesulfonic acid with potassium hydroxide. The reaction proceeds under mild conditions, with a yield of around 85%. No catalysts are typically required for this reaction, which is known for its high selectivity.

About

CAS No 13035-63-7
English Name 4-Iodo-benzenesulfonic acid potassium-salt
Molecular Formula C6H4IKO3S
Molecular Weight 284.07 g/mol
SMILES C1=CC(=CC=C1S(=O)(=O)[O-])I.[K+]
InChIKey UBRJOJKCAVYQSH-UHFFFAOYSA-N
Last Updated: 2025-10-10 13:51

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Iodo-benzenesulfonic acid potassium-salt (CAS: 13035-63-7)?

4-Iodo-benzenesulfonic acid potassium-salt is a white crystalline solid. It has a molecular weight o...

Compound Q&A

What industries use 4-Iodo-benzenesulfonic acid potassium-salt (CAS: 13035-63-7)?

4-Iodo-benzenesulfonic acid potassium-salt is used in the pharmaceutical industry for the production...

Compound Q&A

What precautions should be taken when handling 4-Iodo-benzenesulfonic acid potassium-salt (CAS: 13035-63-7)?

When handling 4-Iodo-benzenesulfonic acid potassium-salt, it is important to wear appropriate person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...