Compound Q&A

What industries use 4-Methoxy-3-nitroaniline (CAS: 577-72-0)?

Answer

4-Methoxy-3-nitroaniline
4-Methoxy-3-nitroaniline (CAS: 577-72-0) finds applications in the pharmaceutical industry, where it serves as an intermediate in the synthesis of various drugs. It is also used in the production of dyes, in sensors, and as a component in the development of certain polymers.

About

CAS No 577-72-0
English Name 4-Methoxy-3-nitroaniline
Molecular Formula C7H8N2O3
Molecular Weight 168.15 g/mol
SMILES COC1=C(C=C(C=C1)N)[N+](=O)[O-]
InChIKey RUFOHZDEBFYQSV-UHFFFAOYSA-N
Last Updated: 2025-10-10 12:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Methoxy-3-nitroaniline (CAS: 577-72-0)?

4-Methoxy-3-nitroaniline (CAS: 577-72-0) is a white crystalline solid with a molecular weight of app...

Compound Q&A

How is 4-Methoxy-3-nitroaniline (CAS: 577-72-0) typically synthesized?

4-Methoxy-3-nitroaniline (CAS: 577-72-0) is commonly synthesized by the nitration of 4-methoxyanilin...

Compound Q&A

What precautions should be taken when handling 4-Methoxy-3-nitroaniline (CAS: 577-72-0)?

When handling 4-Methoxy-3-nitroaniline (CAS: 577-72-0), it is essential to wear appropriate personal...

Compound Q&A

How should 2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) be stored?

2-Methylbenzene-1,4-diamine dihydrochloride (CAS: 615-45-2) should be stored in ...

615-45-22-Methylbenzene-1,4-...
Compound Q&A

Is (1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide (CAS: 132747-20-7) safe?

(1S,4S)-2,5-Diazabicyclo[2.2.1]heptane dihydrobromide is generally considered sa...

132747-20-7(1S,4S)-2,5-Diazabic...
Compound Q&A

What industries use (6-Chloropyridazin-3-YL)methanamine (CAS: 871826-15-2)?

(6-Chloropyridazin-3-YL)methanamine finds applications in the pharmaceutical ind...

871826-15-2(6-Chloropyridazin-3...
Compound Q&A

What are the main uses of 2-Fluoro-3-methylphenol (CAS: 77772-72-6)?

2-Fluoro-3-methylphenol is primarily used in the synthesis of pharmaceuticals, p...

77772-72-62-Fluoro-3-methylphe...