Compound Q&A

What industries use (1H-Benzotriazol-1-yloxy)(di-1-pyrrolidinyl)methylium hexafluorophosphate (CAS: 105379-24-6)?

Answer

(1H-Benzotriazol-1-yloxy)(di-1-pyrrolidinyl)methylium hexafluorophosphate
This compound is used in the pharmaceutical industry for the synthesis of certain medicinal compounds. It is also utilized in the polymer industry for the preparation of functional polymers. Additionally, it has applications in semiconductor fabrication and as a reagent in chemical sensors.

About

English Name (1H-Benzotriazol-1-yloxy)(di-1-pyrrolidinyl)methylium hexafluorophosphate
Molecular Formula C15H21F6N5OP
Molecular Weight 431.32 g/mol
SMILES C1CCN(C1)C(=[N+]2CCCC2)ON3C4=CC=CC=C4N=N3.F[P-](F)(F)(F)(F)F
InChIKey XKTRAGMCMJYRRN-UHFFFAOYSA-N
Last Updated: 2025-10-10 12:21

Related Q&A

Compound Q&A

What are the physical and chemical properties of (1H-Benzotriazol-1-yloxy)(di-1-pyrrolidinyl)methylium hexafluorophosphate (CAS: 105379-24-6)?

This compound is a crystalline solid with a molecular weight of approximately 489.47 g/mol. It is sl...

Compound Q&A

How is (1H-Benzotriazol-1-yloxy)(di-1-pyrrolidinyl)methylium hexafluorophosphate (CAS: 105379-24-6) typically synthesized?

It can be synthesized through the reaction of hexafluorophosphoric anhydride with 1H-benzotriazol-1-...

Compound Q&A

What precautions should be taken when handling (1H-Benzotriazol-1-yloxy)(di-1-pyrrolidinyl)methylium hexafluorophosphate (CAS: 105379-24-6)?

When handling this compound, it is essential to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...