Compound Q&A

What are the physical and chemical properties of (3beta,7beta,12beta)-3,7,12-Trihydroxy-11,15,23-trioxolanost-8-en-26-oic acid (CAS: 98665-22-6)?

Answer

(3beta,7beta,12beta)-3,7,12-Trihydroxy-11,15,23-trioxolanost-8-en-26-oic acid
(3beta,7beta,12beta)-3,7,12-Trihydroxy-11,15,23-trioxolanost-8-en-26-oic acid is a white to off-white crystalline solid with a molecular weight of approximately 514.39 g/mol. It is poorly soluble in water but soluble in organic solvents. The compound exhibits limited reactivity, but caution is advised during synthesis and handling due to its oxygen-containing functional groups. It is stable under normal conditions but may degrade under acidic or basic conditions.

About

CAS No 98665-22-6
English Name (3beta,7beta,12beta)-3,7,12-Trihydroxy-11,15,23-trioxolanost-8-en-26-oic acid
Molecular Formula C30H44O8
Molecular Weight 532.67 g/mol
SMILES CC(CC(=O)CC(C)C(=O)O)C1CC(=O)C2(C1(C(C(=O)C3=C2C(CC4C3(CCC(C4(C)C)O)C)O)O)C)C
InChIKey BPJPBLZKOVIJQD-YYFGTHFASA-N
Last Updated: 2025-10-10 12:21

Related Q&A

Compound Q&A

How is (3beta,7beta,12beta)-3,7,12-Trihydroxy-11,15,23-trioxolanost-8-en-26-oic acid (CAS: 98665-22-6) typically synthesized?

(3beta,7beta,12beta)-3,7,12-Trihydroxy-11,15,23-trioxolanost-8-en-26-oic acid can be synthesized via...

Compound Q&A

What industries use (3beta,7beta,12beta)-3,7,12-Trihydroxy-11,15,23-trioxolanost-8-en-26-oic acid (CAS: 98665-22-6)?

(3beta,7beta,12beta)-3,7,12-Trihydroxy-11,15,23-trioxolanost-8-en-26-oic acid has applications in ph...

Compound Q&A

What precautions should be taken when handling (3beta,7beta,12beta)-3,7,12-Trihydroxy-11,15,23-trioxolanost-8-en-26-oic acid (CAS: 98665-22-6)?

When handling (3beta,7beta,12beta)-3,7,12-Trihydroxy-11,15,23-trioxolanost-8-en-26-oic acid (CAS: 98...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...